CAS 1240570-79-9 is the registry number for 2-((Allylamino)methyl)-4-bromophenol hydrochloride, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-2-[(prop-2-enylamino)methyl]phenol;hydrochloride (CAS 1240570-79-9) is a chemical compound with the molecular formula C10H13BrClNO and a molecular weight of 278.57 g/mol. IUPAC name: 4-bromo-2-[(prop-2-enylamino)methyl]phenol;hydrochloride. InChIKey: YMXNFYHQHOQBCJ-UHFFFAOYSA-N.
| Molecular formula | C10H13BrClNO |
|---|---|
| Molecular weight | 278.57 g/mol |
| IUPAC name | 4-bromo-2-[(prop-2-enylamino)methyl]phenol;hydrochloride |
| InChIKey | YMXNFYHQHOQBCJ-UHFFFAOYSA-N |
| SMILES | C=CCNCC1=C(C=CC(=C1)Br)O.Cl |
Computed by PubChem (NCBI)