Products 1186663-63-7

CAS 1186663-63-7 is the registry number for 4-(4-Bromophenyl)morpholine hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 5g, 100g.

Structural formula: {0} (CAS {1})

4-(4-bromophenyl)morpholine;hydrochloride (CAS 1186663-63-7) is a chemical compound with the molecular formula C10H13BrClNO and a molecular weight of 278.57 g/mol. IUPAC name: 4-(4-bromophenyl)morpholine;hydrochloride. InChIKey: GBGVMVYEGPLMBJ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13BrClNO
Molecular weight278.57 g/mol
IUPAC name4-(4-bromophenyl)morpholine;hydrochloride
InChIKeyGBGVMVYEGPLMBJ-UHFFFAOYSA-N
SMILESC1COCCN1C2=CC=C(C=C2)Br.Cl

Computed by PubChem (NCBI)