Products 197846-83-6

CAS 197846-83-6 is the registry number for 4-(3-Bromophenyl)morpholine hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 100g, 5g, 1g.

Structural formula: {0} (CAS {1})

4-(3-bromophenyl)morpholine;hydrochloride (CAS 197846-83-6) is a chemical compound with the molecular formula C10H13BrClNO and a molecular weight of 278.57 g/mol. IUPAC name: 4-(3-bromophenyl)morpholine;hydrochloride. InChIKey: CVJROQPDPXSCRZ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13BrClNO
Molecular weight278.57 g/mol
IUPAC name4-(3-bromophenyl)morpholine;hydrochloride
InChIKeyCVJROQPDPXSCRZ-UHFFFAOYSA-N
SMILESC1COCCN1C2=CC(=CC=C2)Br.Cl

Computed by PubChem (NCBI)