CAS 1391531-74-0 appears in our catalog under these names: (S)-2-Methyl-1-pyridin-3-yl-propylamine dihydrochloride, 98%, 98%, (S)-2-Methyl-1-pyridin-3-yl-propylamine dihydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(1S)-2-methyl-1-pyridin-3-ylpropan-1-amine;dihydrochloride (CAS 1391531-74-0) is a chemical compound with the molecular formula C9H16Cl2N2 and a molecular weight of 223.14 g/mol. IUPAC name: (1S)-2-methyl-1-pyridin-3-ylpropan-1-amine;dihydrochloride. InChIKey: HRPFEVDYCALKLE-WWPIYYJJSA-N.
| Molecular formula | C9H16Cl2N2 |
|---|---|
| Molecular weight | 223.14 g/mol |
| IUPAC name | (1S)-2-methyl-1-pyridin-3-ylpropan-1-amine;dihydrochloride |
| InChIKey | HRPFEVDYCALKLE-WWPIYYJJSA-N |
| SMILES | CC(C)[C@@H](C1=CN=CC=C1)N.Cl.Cl |
Computed by PubChem (NCBI)