CAS 1391566-83-8 appears in our catalog under these names: Methyl (S)-3-amino-3-(2,3-dimethylphenyl)propanoate hydrochloride, 98%, Methyl (S)-3-amino-3-(2,3-dimethylphenyl)propanoate hydrochloride, 97%, 97%, (S)-Methyl 3-amino-3-(2,3-dimethylphenyl)propanoate hydrochloride, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
Methyl (3S)-3-amino-3-(2,3-dimethylphenyl)propanoate;hydrochloride (CAS 1391566-83-8) is a chemical compound with the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. IUPAC name: methyl (3S)-3-amino-3-(2,3-dimethylphenyl)propanoate;hydrochloride. InChIKey: MVFSJMMOKDOOGD-MERQFXBCSA-N.
| Molecular formula | C12H18ClNO2 |
|---|---|
| Molecular weight | 243.73 g/mol |
| IUPAC name | methyl (3S)-3-amino-3-(2,3-dimethylphenyl)propanoate;hydrochloride |
| InChIKey | MVFSJMMOKDOOGD-MERQFXBCSA-N |
| SMILES | CC1=C(C(=CC=C1)[C@H](CC(=O)OC)N)C.Cl |
Computed by PubChem (NCBI)