CAS 1391734-56-7 is the registry number for (R)–tert–Butyl 3–(3–methoxy–3–oxopropanoyl)piperidine–1–carboxylate. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
Tert-butyl (3R)-3-(3-methoxy-3-oxopropanoyl)piperidine-1-carboxylate (CAS 1391734-56-7) is a chemical compound with the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. IUPAC name: tert-butyl (3R)-3-(3-methoxy-3-oxopropanoyl)piperidine-1-carboxylate. InChIKey: WSZRBHLROKLBBT-SNVBAGLBSA-N.
| Molecular formula | C14H23NO5 |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | tert-butyl (3R)-3-(3-methoxy-3-oxopropanoyl)piperidine-1-carboxylate |
| InChIKey | WSZRBHLROKLBBT-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](C1)C(=O)CC(=O)OC |
Computed by PubChem (NCBI)