Products 1956435-45-2
CAS 1956435-45-2 is the registry number for (S)-tert-Butyl 3-(3-methoxy-3-oxopropanoyl)piperidine-1-carboxylate, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl (3S)-3-(3-methoxy-3-oxopropanoyl)piperidine-1-carboxylate (CAS 1956435-45-2) is a chemical compound with the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. IUPAC name: tert-butyl (3S)-3-(3-methoxy-3-oxopropanoyl)piperidine-1-carboxylate. InChIKey: WSZRBHLROKLBBT-JTQLQIEISA-N.
| Molecular formula | C14H23NO5 |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | tert-butyl (3S)-3-(3-methoxy-3-oxopropanoyl)piperidine-1-carboxylate |
| InChIKey | WSZRBHLROKLBBT-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](C1)C(=O)CC(=O)OC |
Computed by PubChem (NCBI)