CAS 1392219-07-6 appears in our catalog under these names: (R)–6–Methoxychroman–4–amine hydrochloride, (R)-6-Methoxychroman-4-amine hydrochloride, 97%, (4R)-6-Methoxy-3,4-dihydro-2h-1-benzopyran-4-amine hydrochloride, 95%, (4R)-6-Methoxy-3,4-dihydro-2H-1-benzopyran-4-amine hydrochloride, (R)-6-Methoxychroman-4-amine hydrochloride, 97%, 97%. Offered by: GLPBio, Fluorochem, Combi-blocks, Biosynth, Chemat. Available pack sizes: 100mg, 250mg, 1g, 0,5g, 50mg.
(4R)-6-methoxy-3,4-dihydro-2H-chromen-4-amine;hydrochloride (CAS 1392219-07-6) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: (4R)-6-methoxy-3,4-dihydro-2H-chromen-4-amine;hydrochloride. InChIKey: UOSQHESJUHEMLZ-SBSPUUFOSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | (4R)-6-methoxy-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| InChIKey | UOSQHESJUHEMLZ-SBSPUUFOSA-N |
| SMILES | COC1=CC2=C(C=C1)OCC[C@H]2N.Cl |
Computed by PubChem (NCBI)