Products 52992-48-0
CAS 52992-48-0 appears in our catalog under these names: (R)-4-Amino-3-phenylbutanoic acid hydrochloride, 97%, (R)-4-Amino-3-phenylbutanoic acid hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 500mg, 1000mg, 2000mg.
(3R)-4-amino-3-phenylbutanoic acid;hydrochloride (CAS 52992-48-0) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: (3R)-4-amino-3-phenylbutanoic acid;hydrochloride. InChIKey: XSYRYMGYPBGOPS-FVGYRXGTSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | (3R)-4-amino-3-phenylbutanoic acid;hydrochloride |
| InChIKey | XSYRYMGYPBGOPS-FVGYRXGTSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](CC(=O)O)CN.Cl |
Computed by PubChem (NCBI)
Synonyms:
(R)-4-Amino-3-phenylbutanoic acid hydrochloride, (R)-4-Amino-3-phenylbutyric acid hydrochloride, 4-Amino-3-phenylbutyric acid hydrochloride, (R)-, (-)-4-Amino-3-phenylbutyric acid hydrochloride, (3R)-4-amino-3-phenylbutanoic acid;hydrochloride, (3R)-4-amino-3-phenylbutanoic acid hydrochloride, (3R)-4-amino-3-phenyl-butanoic acid;hydrochloride