Products 103096-02-2
CAS 103096-02-2 appears in our catalog under these names: methyl 3-(3-aminophenyl)propanoate hydrochloride, 95%, 3-Amino-benzenepropanoic acid methyl ester hydrochloride, 95%, Methyl 3-(3-aminophenyl)propanoate hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 0,5g.
Methyl 3-(3-aminophenyl)propanoate;hydrochloride (CAS 103096-02-2) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: methyl 3-(3-aminophenyl)propanoate;hydrochloride. InChIKey: UPXYAKKZOLELBU-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | methyl 3-(3-aminophenyl)propanoate;hydrochloride |
| InChIKey | UPXYAKKZOLELBU-UHFFFAOYSA-N |
| SMILES | COC(=O)CCC1=CC(=CC=C1)N.Cl |
Computed by PubChem (NCBI)