Products 58685-78-2
CAS 58685-78-2 appears in our catalog under these names: 2-(Dimethylamino)-2-phenylacetic acid hydrochloride, 2-(Dimethylamino)-2-phenylacetic acid hydrochloride, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 5g, 0,5g, 1g, 100mg, 250mg, 10g.
2-(dimethylamino)-2-phenylacetic acid;hydrochloride (CAS 58685-78-2) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: 2-(dimethylamino)-2-phenylacetic acid;hydrochloride. InChIKey: FQYXFGONKKDOKW-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | 2-(dimethylamino)-2-phenylacetic acid;hydrochloride |
| InChIKey | FQYXFGONKKDOKW-UHFFFAOYSA-N |
| SMILES | CN(C)C(C1=CC=CC=C1)C(=O)O.Cl |
Computed by PubChem (NCBI)