Products 1391439-19-2
CAS 1391439-19-2 appears in our catalog under these names: (S)-3-(1-Amino-ethyl)-benzoic acid methyl ester hydrochloride, 95%, (S)–Methyl 3–(1–aminoethyl)benzoate hydrochloride, (S)-Methyl 3-(1-aminoethyl)benzoate hydrochloride ee, (S)-Methyl 3-(1-aminoethyl)benzoate hydrochloride, 97%, 97%, (S)-METHYL 3-(1-AMINOETHYL)BENZOATE HCL, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 5g, 1g, 50mg, 500mg.
Methyl 3-[(1S)-1-aminoethyl]benzoate;hydrochloride (CAS 1391439-19-2) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: methyl 3-[(1S)-1-aminoethyl]benzoate;hydrochloride. InChIKey: PMFQSOTUHJSZHY-FJXQXJEOSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | methyl 3-[(1S)-1-aminoethyl]benzoate;hydrochloride |
| InChIKey | PMFQSOTUHJSZHY-FJXQXJEOSA-N |
| SMILES | C[C@@H](C1=CC(=CC=C1)C(=O)OC)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
(S)-Methyl 3-(1-aminoethyl)benzoate hydrochloride, (S)-3-(1-Amino-ethyl)-benzoic acid methyl ester hydrochloride, methyl (S)-3-(1-aminoethyl)benzoate hydrochloride, (S)-Methyl 3-(1-aminoethyl)benzoate HCl, methyl 3-[(1S)-1-aminoethyl]benzoate;hydrochloride, (S)-Methyl 3-(1-aminoethyl)benzoate hydrochloride ee, (S)-Methyl3-(1-aminoethyl)benzoatehydrochloride, methyl 3-[(1S)-1-aminoethyl]benzoate hydrochloride, (S)-3-(1-Amino-ethyl)-benzoic acid methyl ester hydrochloride, AldrichCPR