CAS 139229-60-0 appears in our catalog under these names: 1-((4-Fluorophenyl)methyl)cyclopropane-1-carboxylic acid, 1-(4-Fluorobenzyl)cyclopropanecarboxylic acid, 1-[(4-Fluorophenyl)methyl]cyclopropane-1-carboxylic acid. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
1-[(4-fluorophenyl)methyl]cyclopropane-1-carboxylic acid (CAS 139229-60-0) is a chemical compound with the molecular formula C11H11FO2 and a molecular weight of 194.20 g/mol. IUPAC name: 1-[(4-fluorophenyl)methyl]cyclopropane-1-carboxylic acid. InChIKey: JESFUYHNUATMNP-UHFFFAOYSA-N.
| Molecular formula | C11H11FO2 |
|---|---|
| Molecular weight | 194.20 g/mol |
| IUPAC name | 1-[(4-fluorophenyl)methyl]cyclopropane-1-carboxylic acid |
| InChIKey | JESFUYHNUATMNP-UHFFFAOYSA-N |
| SMILES | C1CC1(CC2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)