Products 1392415-54-1
CAS 1392415-54-1 is the registry number for (4-Chloro-3-(methoxymethyl)phenyl)boronic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[4-chloro-3-(methoxymethyl)phenyl]boronic acid (CAS 1392415-54-1) is a chemical compound with the molecular formula C8H10BClO3 and a molecular weight of 200.43 g/mol. IUPAC name: [4-chloro-3-(methoxymethyl)phenyl]boronic acid. InChIKey: WKYVZGJDFXPORR-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO3 |
|---|---|
| Molecular weight | 200.43 g/mol |
| IUPAC name | [4-chloro-3-(methoxymethyl)phenyl]boronic acid |
| InChIKey | WKYVZGJDFXPORR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)COC)(O)O |
Computed by PubChem (NCBI)