CAS 1392745-19-5 appears in our catalog under these names: (1R,3S,4S)-3-Amino-4-hydroxy-cyclohexanecarboxylic acid ethyl ester hydrochloride, 97%, (1R,3S,4S)-3-Amino-4-hydroxy-cyclohexanecarboxylic acid ethyl ester hydrochloride, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g.
Ethyl (1R,3S,4S)-3-amino-4-hydroxycyclohexane-1-carboxylate;hydrochloride (CAS 1392745-19-5) is a chemical compound with the molecular formula C9H18ClNO3 and a molecular weight of 223.70 g/mol. IUPAC name: ethyl (1R,3S,4S)-3-amino-4-hydroxycyclohexane-1-carboxylate;hydrochloride. InChIKey: ZEWLEQMKDHDCHV-MWDCIYOWSA-N.
| Molecular formula | C9H18ClNO3 |
|---|---|
| Molecular weight | 223.70 g/mol |
| IUPAC name | ethyl (1R,3S,4S)-3-amino-4-hydroxycyclohexane-1-carboxylate;hydrochloride |
| InChIKey | ZEWLEQMKDHDCHV-MWDCIYOWSA-N |
| SMILES | CCOC(=O)[C@@H]1CC[C@@H]([C@H](C1)N)O.Cl |
Computed by PubChem (NCBI)