CAS 1393112-57-6 appears in our catalog under these names: (R)-2-Amino-2-(naphthalen-2-yl)acetic acid hydrochloride, 95%, (R)–2–Amino–2–(naphthalen–2–yl)acetic acid hydrochloride. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
(2R)-2-amino-2-naphthalen-2-ylacetic acid;hydrochloride (CAS 1393112-57-6) is a chemical compound with the molecular formula C12H12ClNO2 and a molecular weight of 237.68 g/mol. IUPAC name: (2R)-2-amino-2-naphthalen-2-ylacetic acid;hydrochloride. InChIKey: BGWXXGCAWFXWAO-RFVHGSKJSA-N.
| Molecular formula | C12H12ClNO2 |
|---|---|
| Molecular weight | 237.68 g/mol |
| IUPAC name | (2R)-2-amino-2-naphthalen-2-ylacetic acid;hydrochloride |
| InChIKey | BGWXXGCAWFXWAO-RFVHGSKJSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)[C@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)