CAS 139336-31-5 is the registry number for 5-[(E)-2-Thienylmethylidene]-1,3-thiazolane-2,4-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dione (CAS 139336-31-5) is a chemical compound with the molecular formula C8H5NO2S2 and a molecular weight of 211.3 g/mol. IUPAC name: 5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dione. InChIKey: DOOLJLRRQAYVGK-UHFFFAOYSA-N.
| Molecular formula | C8H5NO2S2 |
|---|---|
| Molecular weight | 211.3 g/mol |
| IUPAC name | 5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dione |
| InChIKey | DOOLJLRRQAYVGK-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C=C2C(=O)NC(=O)S2 |
Computed by PubChem (NCBI)