CAS 933760-21-5 appears in our catalog under these names: 2-(Thiophen-2-yl)-1,3-thiazole-5-carboxylic acid, 95%, 2-(Thiophen-2-yl)-1,3-thiazole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 1g, 100mg.
2-thiophen-2-yl-1,3-thiazole-5-carboxylic acid (CAS 933760-21-5) is a chemical compound with the molecular formula C8H5NO2S2 and a molecular weight of 211.3 g/mol. IUPAC name: 2-thiophen-2-yl-1,3-thiazole-5-carboxylic acid. InChIKey: CODFJGNBJOPGQV-UHFFFAOYSA-N.
| Molecular formula | C8H5NO2S2 |
|---|---|
| Molecular weight | 211.3 g/mol |
| IUPAC name | 2-thiophen-2-yl-1,3-thiazole-5-carboxylic acid |
| InChIKey | CODFJGNBJOPGQV-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=NC=C(S2)C(=O)O |
Computed by PubChem (NCBI)