CAS 847956-14-3 is the registry number for 4-(Thiophen-2-yl)thiazole-2-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
4-thiophen-2-yl-1,3-thiazole-2-carboxylic acid (CAS 847956-14-3) is a chemical compound with the molecular formula C8H5NO2S2 and a molecular weight of 211.3 g/mol. IUPAC name: 4-thiophen-2-yl-1,3-thiazole-2-carboxylic acid. InChIKey: YOPZXZBRLUDDIY-UHFFFAOYSA-N.
| Molecular formula | C8H5NO2S2 |
|---|---|
| Molecular weight | 211.3 g/mol |
| IUPAC name | 4-thiophen-2-yl-1,3-thiazole-2-carboxylic acid |
| InChIKey | YOPZXZBRLUDDIY-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CSC(=N2)C(=O)O |
Computed by PubChem (NCBI)