CAS 868238-00-0 appears in our catalog under these names: 2-Thien-3-yl-1,3-thiazole-4-carboxylic acid, 98%, 2-(Thiophen-3-yl)-1,3-thiazole-4-carboxylic acid, 95%, 2-(Thiophen-3-yl)-1,3-thiazole-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 2,5g.
2-thiophen-3-yl-1,3-thiazole-4-carboxylic acid (CAS 868238-00-0) is a chemical compound with the molecular formula C8H5NO2S2 and a molecular weight of 211.3 g/mol. IUPAC name: 2-thiophen-3-yl-1,3-thiazole-4-carboxylic acid. InChIKey: JZSRMMAFRQYIHP-UHFFFAOYSA-N.
| Molecular formula | C8H5NO2S2 |
|---|---|
| Molecular weight | 211.3 g/mol |
| IUPAC name | 2-thiophen-3-yl-1,3-thiazole-4-carboxylic acid |
| InChIKey | JZSRMMAFRQYIHP-UHFFFAOYSA-N |
| SMILES | C1=CSC=C1C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)