Products 887201-16-3

CAS 887201-16-3 is the registry number for 5-(1,3-Thiazol-2-yl)thiophene-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-(1,3-thiazol-2-yl)thiophene-2-carboxylic acid (CAS 887201-16-3) is a chemical compound with the molecular formula C8H5NO2S2 and a molecular weight of 211.3 g/mol. IUPAC name: 5-(1,3-thiazol-2-yl)thiophene-2-carboxylic acid. InChIKey: JOQDQGHUGZODMF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5NO2S2
Molecular weight211.3 g/mol
IUPAC name5-(1,3-thiazol-2-yl)thiophene-2-carboxylic acid
InChIKeyJOQDQGHUGZODMF-UHFFFAOYSA-N
SMILESC1=CSC(=N1)C2=CC=C(S2)C(=O)O

Computed by PubChem (NCBI)