CAS 887201-16-3 is the registry number for 5-(1,3-Thiazol-2-yl)thiophene-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.
5-(1,3-thiazol-2-yl)thiophene-2-carboxylic acid (CAS 887201-16-3) is a chemical compound with the molecular formula C8H5NO2S2 and a molecular weight of 211.3 g/mol. IUPAC name: 5-(1,3-thiazol-2-yl)thiophene-2-carboxylic acid. InChIKey: JOQDQGHUGZODMF-UHFFFAOYSA-N.
| Molecular formula | C8H5NO2S2 |
|---|---|
| Molecular weight | 211.3 g/mol |
| IUPAC name | 5-(1,3-thiazol-2-yl)thiophene-2-carboxylic acid |
| InChIKey | JOQDQGHUGZODMF-UHFFFAOYSA-N |
| SMILES | C1=CSC(=N1)C2=CC=C(S2)C(=O)O |
Computed by PubChem (NCBI)