Products 1393371-35-1
CAS 1393371-35-1 is the registry number for MHY884. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(5-chloro-2,3-dihydro-1,3-benzothiazol-2-yl)-2,6-dimethoxyphenol (CAS 1393371-35-1) is a chemical compound with the molecular formula C15H14ClNO3S and a molecular weight of 323.8 g/mol. IUPAC name: 4-(5-chloro-2,3-dihydro-1,3-benzothiazol-2-yl)-2,6-dimethoxyphenol. InChIKey: LQDWIAAYFSZPAR-UHFFFAOYSA-N.
| Molecular formula | C15H14ClNO3S |
|---|---|
| Molecular weight | 323.8 g/mol |
| IUPAC name | 4-(5-chloro-2,3-dihydro-1,3-benzothiazol-2-yl)-2,6-dimethoxyphenol |
| InChIKey | LQDWIAAYFSZPAR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1O)OC)C2NC3=C(S2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)