Products 13934-03-7
CAS 13934-03-7 appears in our catalog under these names: Pyridoxylidene–L–glutamic Acid Dipotassium Salt, Pyridoxylideneglutamic acid. Offered by: GLPBio, MedChemExpress. Available pack sizes: 250mg, Get quote.
(2S)-2-[[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylideneamino]pentanedioic acid (CAS 13934-03-7) is a chemical compound with the molecular formula C13H16N2O6 and a molecular weight of 296.28 g/mol. IUPAC name: (2S)-2-[[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylideneamino]pentanedioic acid. InChIKey: KDIGYCWRAAYWTQ-JTQLQIEISA-N.
| Molecular formula | C13H16N2O6 |
|---|---|
| Molecular weight | 296.28 g/mol |
| IUPAC name | (2S)-2-[[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylideneamino]pentanedioic acid |
| InChIKey | KDIGYCWRAAYWTQ-JTQLQIEISA-N |
| SMILES | CC1=NC=C(C(=C1O)C=N[C@@H](CCC(=O)O)C(=O)O)CO |
Computed by PubChem (NCBI)