CAS 512180-63-1 appears in our catalog under these names: 2–(4–((tert–Butoxycarbonyl)amino)–2–nitrophenyl)acetic acid, 2-(4-((tert-Butoxycarbonyl)amino)-2-nitrophenyl)acetic acid 95%. Offered by: GLPBio, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-nitrophenyl]acetic acid (CAS 512180-63-1) is a chemical compound with the molecular formula C13H16N2O6 and a molecular weight of 296.28 g/mol. IUPAC name: 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-nitrophenyl]acetic acid. InChIKey: NIDVJUQDFSSGCK-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O6 |
|---|---|
| Molecular weight | 296.28 g/mol |
| IUPAC name | 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-nitrophenyl]acetic acid |
| InChIKey | NIDVJUQDFSSGCK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=C(C=C1)CC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)