CAS 1638771-29-5 is the registry number for 3,5-Bis((dimethylcarbamoyl)oxy)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,5-bis(dimethylcarbamoyloxy)benzoic acid (CAS 1638771-29-5) is a chemical compound with the molecular formula C13H16N2O6 and a molecular weight of 296.28 g/mol. IUPAC name: 3,5-bis(dimethylcarbamoyloxy)benzoic acid. InChIKey: UKQTXNMVTCQDAH-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O6 |
|---|---|
| Molecular weight | 296.28 g/mol |
| IUPAC name | 3,5-bis(dimethylcarbamoyloxy)benzoic acid |
| InChIKey | UKQTXNMVTCQDAH-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)OC1=CC(=CC(=C1)C(=O)O)OC(=O)N(C)C |
Computed by PubChem (NCBI)