Products 40958-11-0
CAS 40958-11-0 appears in our catalog under these names: Corynecin IV, Corynecin IV. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 25mg, 1mg, Get quote.
[(2R,3R)-2-acetamido-3-hydroxy-3-(4-nitrophenyl)propyl] acetate (CAS 40958-11-0) is a chemical compound with the molecular formula C13H16N2O6 and a molecular weight of 296.28 g/mol. IUPAC name: [(2R,3R)-2-acetamido-3-hydroxy-3-(4-nitrophenyl)propyl] acetate. InChIKey: BDRQNWQWGITGRM-CHWSQXEVSA-N.
| Molecular formula | C13H16N2O6 |
|---|---|
| Molecular weight | 296.28 g/mol |
| IUPAC name | [(2R,3R)-2-acetamido-3-hydroxy-3-(4-nitrophenyl)propyl] acetate |
| InChIKey | BDRQNWQWGITGRM-CHWSQXEVSA-N |
| SMILES | CC(=O)N[C@H](COC(=O)C)[C@@H](C1=CC=C(C=C1)[N+](=O)[O-])O |
Computed by PubChem (NCBI)