CAS 2487-01-6 is the registry number for Medinoterb acetate. Offered by: Dr. Ehrenstorfer. Available pack sizes: 100mg.
(6-tert-butyl-3-methyl-2,4-dinitrophenyl) acetate (CAS 2487-01-6) is a chemical compound with the molecular formula C13H16N2O6 and a molecular weight of 296.28 g/mol. IUPAC name: (6-tert-butyl-3-methyl-2,4-dinitrophenyl) acetate. InChIKey: LWULXYSYLOIDQY-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O6 |
|---|---|
| Molecular weight | 296.28 g/mol |
| IUPAC name | (6-tert-butyl-3-methyl-2,4-dinitrophenyl) acetate |
| InChIKey | LWULXYSYLOIDQY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=C1[N+](=O)[O-])OC(=O)C)C(C)(C)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)