Products 1393568-79-0
CAS 1393568-79-0 appears in our catalog under these names: 7-Chloro-2,6-naphthyridin-1(2H)-one, 97%, 7-Chloro-2,6-naphthyridin-1(2H)-one, 95%, 7-CHLORO-2,6-NAPHTHYRIDIN-1(2H)-ONE, 98%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500mg.
7-chloro-2H-2,6-naphthyridin-1-one (CAS 1393568-79-0) is a chemical compound with the molecular formula C8H5ClN2O and a molecular weight of 180.59 g/mol. IUPAC name: 7-chloro-2H-2,6-naphthyridin-1-one. InChIKey: LWBOYUZYAWEGJL-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 7-chloro-2H-2,6-naphthyridin-1-one |
| InChIKey | LWBOYUZYAWEGJL-UHFFFAOYSA-N |
| SMILES | C1=CNC(=O)C2=CC(=NC=C21)Cl |
Computed by PubChem (NCBI)