CAS 1394003-98-5 appears in our catalog under these names: 6-Chloro-1,2-dihydro-1,5-naphthyridin-2-one, 6-Chloro-1,5-naphthyridin-2(1H)-one, 97%, 97%, 6-Chloro-1,5-naphthyridin-2(1H)-one, 97%, 6-Chloro-1,5-naphthyridin-2(1H)-one, 95%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 0,5g, 1g, 100mg, 250mg.
6-chloro-1H-1,5-naphthyridin-2-one (CAS 1394003-98-5) is a chemical compound with the molecular formula C8H5ClN2O and a molecular weight of 180.59 g/mol. IUPAC name: 6-chloro-1H-1,5-naphthyridin-2-one. InChIKey: JPPALMUZMRZGSL-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 6-chloro-1H-1,5-naphthyridin-2-one |
| InChIKey | JPPALMUZMRZGSL-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1NC(=O)C=C2)Cl |
Computed by PubChem (NCBI)