CAS 1394041-26-9 appears in our catalog under these names: Methyl 3-amino-2,2-dimethyl-3-phenylpropanoate hydrochloride, 95%, Methyl 3-amino-2,2-dimethyl-3-phenylpropanoate hydrochloride, Methyl 3-amino-2,2-dimethyl-3-phenylpropanoate hydrochloride, 95%, 95%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 50mg, 0,5g, 100mg, 250mg.
Methyl 3-amino-2,2-dimethyl-3-phenylpropanoate;hydrochloride (CAS 1394041-26-9) is a chemical compound with the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. IUPAC name: methyl 3-amino-2,2-dimethyl-3-phenylpropanoate;hydrochloride. InChIKey: WZSIDDCDYAZFDD-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO2 |
|---|---|
| Molecular weight | 243.73 g/mol |
| IUPAC name | methyl 3-amino-2,2-dimethyl-3-phenylpropanoate;hydrochloride |
| InChIKey | WZSIDDCDYAZFDD-UHFFFAOYSA-N |
| SMILES | CC(C)(C(C1=CC=CC=C1)N)C(=O)OC.Cl |
Computed by PubChem (NCBI)