CAS 1394042-00-2 appears in our catalog under these names: Methyl 2-{(4-(aminomethyl)phenyl)methanesulfonyl}acetate hydrochloride, Methyl 2-{(4-(aminomethyl)phenyl)methanesulfonyl}acetate hydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
Methyl 2-[[4-(aminomethyl)phenyl]methylsulfonyl]acetate;hydrochloride (CAS 1394042-00-2) is a chemical compound with the molecular formula C11H16ClNO4S and a molecular weight of 293.77 g/mol. IUPAC name: methyl 2-[[4-(aminomethyl)phenyl]methylsulfonyl]acetate;hydrochloride. InChIKey: VZMIQXCAWNCVMH-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO4S |
|---|---|
| Molecular weight | 293.77 g/mol |
| IUPAC name | methyl 2-[[4-(aminomethyl)phenyl]methylsulfonyl]acetate;hydrochloride |
| InChIKey | VZMIQXCAWNCVMH-UHFFFAOYSA-N |
| SMILES | COC(=O)CS(=O)(=O)CC1=CC=C(C=C1)CN.Cl |
Computed by PubChem (NCBI)