Products 1956318-47-0

CAS 1956318-47-0 is the registry number for Methyl 2-amino-3-(3-(methylsulfonyl)phenyl)propanoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 2-amino-3-(3-methylsulfonylphenyl)propanoate;hydrochloride (CAS 1956318-47-0) is a chemical compound with the molecular formula C11H16ClNO4S and a molecular weight of 293.77 g/mol. IUPAC name: methyl 2-amino-3-(3-methylsulfonylphenyl)propanoate;hydrochloride. InChIKey: VUUYKOLKOIYVCR-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16ClNO4S
Molecular weight293.77 g/mol
IUPAC namemethyl 2-amino-3-(3-methylsulfonylphenyl)propanoate;hydrochloride
InChIKeyVUUYKOLKOIYVCR-UHFFFAOYSA-N
SMILESCOC(=O)C(CC1=CC(=CC=C1)S(=O)(=O)C)N.Cl

Computed by PubChem (NCBI)