CAS 851785-21-2 appears in our catalog under these names: (S)-Methyl 2-amino-3-(3-(methylsulfonyl)phenyl)propanoate hydrochloride, 95%, (S)–Methyl 2–amino–3–(3–(methylsulfonyl)phenyl)propanoate hydrochloride, (S)-Methyl 2-amino-3-(3-(methylsulfonyl)phenyl)propanoate hydrochloride, 98%, 98%, (S)-Methyl 2-amino-3-(3-(methylsulfonyl)phenyl)propanoate hydrochloride, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g.
Methyl (2S)-2-amino-3-(3-methylsulfonylphenyl)propanoate;hydrochloride (CAS 851785-21-2) is a chemical compound with the molecular formula C11H16ClNO4S and a molecular weight of 293.77 g/mol. IUPAC name: methyl (2S)-2-amino-3-(3-methylsulfonylphenyl)propanoate;hydrochloride. InChIKey: VUUYKOLKOIYVCR-PPHPATTJSA-N.
| Molecular formula | C11H16ClNO4S |
|---|---|
| Molecular weight | 293.77 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(3-methylsulfonylphenyl)propanoate;hydrochloride |
| InChIKey | VUUYKOLKOIYVCR-PPHPATTJSA-N |
| SMILES | COC(=O)[C@H](CC1=CC(=CC=C1)S(=O)(=O)C)N.Cl |
Computed by PubChem (NCBI)