CAS 2279121-89-8 is the registry number for 2-Amino-3-(4-methanesulfonyl-phenyl)-propionic acid methyl ester hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 2-amino-3-(4-methylsulfonylphenyl)propanoate;hydrochloride (CAS 2279121-89-8) is a chemical compound with the molecular formula C11H16ClNO4S and a molecular weight of 293.77 g/mol. IUPAC name: methyl 2-amino-3-(4-methylsulfonylphenyl)propanoate;hydrochloride. InChIKey: QKVUGPWLZLZQJL-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO4S |
|---|---|
| Molecular weight | 293.77 g/mol |
| IUPAC name | methyl 2-amino-3-(4-methylsulfonylphenyl)propanoate;hydrochloride |
| InChIKey | QKVUGPWLZLZQJL-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC1=CC=C(C=C1)S(=O)(=O)C)N.Cl |
Computed by PubChem (NCBI)