CAS 2049127-84-4 appears in our catalog under these names: Lifitegrast Impurity 33 HCl, (R)–Methyl 2–amino–3–(3–(methylsulfonyl)phenyl)propanoate hydrochloride. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 1g, 250mg.
Methyl (2R)-2-amino-3-(3-methylsulfonylphenyl)propanoate;hydrochloride (CAS 2049127-84-4) is a chemical compound with the molecular formula C11H16ClNO4S and a molecular weight of 293.77 g/mol. IUPAC name: methyl (2R)-2-amino-3-(3-methylsulfonylphenyl)propanoate;hydrochloride. InChIKey: VUUYKOLKOIYVCR-HNCPQSOCSA-N.
| Molecular formula | C11H16ClNO4S |
|---|---|
| Molecular weight | 293.77 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-(3-methylsulfonylphenyl)propanoate;hydrochloride |
| InChIKey | VUUYKOLKOIYVCR-HNCPQSOCSA-N |
| SMILES | COC(=O)[C@@H](CC1=CC(=CC=C1)S(=O)(=O)C)N.Cl |
Computed by PubChem (NCBI)