CAS 1394793-36-2 is the registry number for 2-(2-Fluoro-5-methylphenoxy)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
2-(2-fluoro-5-methylphenoxy)acetic acid (CAS 1394793-36-2) is a chemical compound with the molecular formula C9H9FO3 and a molecular weight of 184.16 g/mol. IUPAC name: 2-(2-fluoro-5-methylphenoxy)acetic acid. InChIKey: JCFRRAPQGHMBLT-UHFFFAOYSA-N.
| Molecular formula | C9H9FO3 |
|---|---|
| Molecular weight | 184.16 g/mol |
| IUPAC name | 2-(2-fluoro-5-methylphenoxy)acetic acid |
| InChIKey | JCFRRAPQGHMBLT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)F)OCC(=O)O |
Computed by PubChem (NCBI)