Products 13949-67-2
CAS 13949-67-2 appears in our catalog under these names: 2-(1-Naphthyloxy)-propionic acid (NOPA), 2-(Naphthalen-1-yloxy)propanoic acid, 95%, 2-(Naphthalen-1-yloxy)propanoic acid, 98%, 2-(1-Naphthyloxy)propanoic Acid, >95% (HPLC). Offered by: Dr. Ehrenstorfer, Combi-blocks, Chemat Brand, TRC. Available pack sizes: 50mg, 1g, 5g, on request, 100mg, 500mg.
2-naphthalen-1-yloxypropanoic acid (CAS 13949-67-2) is a chemical compound with the molecular formula C13H12O3 and a molecular weight of 216.23 g/mol. IUPAC name: 2-naphthalen-1-yloxypropanoic acid. InChIKey: KTAVXDDWEGVLRN-UHFFFAOYSA-N.
| Molecular formula | C13H12O3 |
|---|---|
| Molecular weight | 216.23 g/mol |
| IUPAC name | 2-naphthalen-1-yloxypropanoic acid |
| InChIKey | KTAVXDDWEGVLRN-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)OC1=CC=CC2=CC=CC=C21 |
Computed by PubChem (NCBI)
Synonyms:
2-(naphthalen-1-yloxy)propanoic acid, Propanoic acid, 2-(1-naphthalenyloxy)-, Propionic acid, 2-(1-naphthoxy)-, Propionic acid, 2-(1-naphthyloxy)-, 2-(1-naphthyloxy)propanoic acid, 2-naphthalen-1-yloxypropanoic acid, 2-(1-Naphthyloxy)-propionic acid (NOPA), 2-naphthyloxypropanoic acid, napropamide TP, 2-(1-Naphthoxy) propionoic acid