CAS 1394967-33-9 is the registry number for 4-fluoro-3-hydroxy-5-nitrobenzamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g.
4-fluoro-3-hydroxy-5-nitrobenzamide (CAS 1394967-33-9) is a chemical compound with the molecular formula C7H5FN2O4 and a molecular weight of 200.12 g/mol. IUPAC name: 4-fluoro-3-hydroxy-5-nitrobenzamide. InChIKey: DFNNMEPVNDSUSN-UHFFFAOYSA-N.
| Molecular formula | C7H5FN2O4 |
|---|---|
| Molecular weight | 200.12 g/mol |
| IUPAC name | 4-fluoro-3-hydroxy-5-nitrobenzamide |
| InChIKey | DFNNMEPVNDSUSN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])F)O)C(=O)N |
Computed by PubChem (NCBI)