Products 1395038-04-6
CAS 1395038-04-6 is the registry number for 4-(Trifluoromethoxy)benzene-1,3-diol, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 1g.
4-(trifluoromethoxy)benzene-1,3-diol (CAS 1395038-04-6) is a chemical compound with the molecular formula C7H5F3O3 and a molecular weight of 194.11 g/mol. IUPAC name: 4-(trifluoromethoxy)benzene-1,3-diol. InChIKey: WQDAONGFOJASSW-UHFFFAOYSA-N.
| Molecular formula | C7H5F3O3 |
|---|---|
| Molecular weight | 194.11 g/mol |
| IUPAC name | 4-(trifluoromethoxy)benzene-1,3-diol |
| InChIKey | WQDAONGFOJASSW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)O)OC(F)(F)F |
Computed by PubChem (NCBI)