Products 1330754-61-4

CAS 1330754-61-4 is the registry number for 2-(2-(Trifluoromethyl)furan-3-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[2-(trifluoromethyl)furan-3-yl]acetic acid (CAS 1330754-61-4) is a chemical compound with the molecular formula C7H5F3O3 and a molecular weight of 194.11 g/mol. IUPAC name: 2-[2-(trifluoromethyl)furan-3-yl]acetic acid. InChIKey: KRBHCBKWLCUHDW-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5F3O3
Molecular weight194.11 g/mol
IUPAC name2-[2-(trifluoromethyl)furan-3-yl]acetic acid
InChIKeyKRBHCBKWLCUHDW-UHFFFAOYSA-N
SMILESC1=COC(=C1CC(=O)O)C(F)(F)F

Computed by PubChem (NCBI)