CAS 17515-74-1 appears in our catalog under these names: 5-Methyl-2-(trifluoromethyl)-3-furoic acid, 97% , 5-Methyl-2-(trifluoromethyl)-3-furoic acid, 97%, 5-Methyl-2-(trifluoromethyl)furan-3-carboxylic acid, 97%. Offered by: Thermo Scientific, Fluorochem, Ambeed. Available pack sizes: 250MG, 1g, 5g, 25g, 10g.
5-methyl-2-(trifluoromethyl)furan-3-carboxylic acid (CAS 17515-74-1) is a chemical compound with the molecular formula C7H5F3O3 and a molecular weight of 194.11 g/mol. IUPAC name: 5-methyl-2-(trifluoromethyl)furan-3-carboxylic acid. InChIKey: NURNFMNHTHXTDS-UHFFFAOYSA-N.
| Molecular formula | C7H5F3O3 |
|---|---|
| Molecular weight | 194.11 g/mol |
| IUPAC name | 5-methyl-2-(trifluoromethyl)furan-3-carboxylic acid |
| InChIKey | NURNFMNHTHXTDS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(O1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)