CAS 1464926-20-2 is the registry number for 2-Methyl-5-(trifluoromethyl)furan-3-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
2-methyl-5-(trifluoromethyl)furan-3-carboxylic acid (CAS 1464926-20-2) is a chemical compound with the molecular formula C7H5F3O3 and a molecular weight of 194.11 g/mol. IUPAC name: 2-methyl-5-(trifluoromethyl)furan-3-carboxylic acid. InChIKey: LPHPNVKQRGZXLH-UHFFFAOYSA-N.
| Molecular formula | C7H5F3O3 |
|---|---|
| Molecular weight | 194.11 g/mol |
| IUPAC name | 2-methyl-5-(trifluoromethyl)furan-3-carboxylic acid |
| InChIKey | LPHPNVKQRGZXLH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(O1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)