Products 187927-51-1
CAS 187927-51-1 is the registry number for 4-(Trifluoromethoxy)benzene-1,2-diol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
4-(trifluoromethoxy)benzene-1,2-diol (CAS 187927-51-1) is a chemical compound with the molecular formula C7H5F3O3 and a molecular weight of 194.11 g/mol. IUPAC name: 4-(trifluoromethoxy)benzene-1,2-diol. InChIKey: FKLFKJZWLIDCGY-UHFFFAOYSA-N.
| Molecular formula | C7H5F3O3 |
|---|---|
| Molecular weight | 194.11 g/mol |
| IUPAC name | 4-(trifluoromethoxy)benzene-1,2-diol |
| InChIKey | FKLFKJZWLIDCGY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)O)O |
Computed by PubChem (NCBI)