CAS 26431-53-8 appears in our catalog under these names: 2-Methyl-4-(trifluoromethyl)-3-furancarboxylic acid, 95%, 2-Methyl-4-(trifluoromethyl)-3-furancarboxylic Acid, 2-Methyl-4-(trifluoromethyl)furan-3-carboxylic acid, 98+%, 2–Methyl–4–(trifluoromethyl)furan–3–carboxylic acid. Offered by: Combi-blocks, TRC, AmBeed, GLPBio, Biosynth. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg, 0,5g.
2-methyl-4-(trifluoromethyl)furan-3-carboxylic acid (CAS 26431-53-8) is a chemical compound with the molecular formula C7H5F3O3 and a molecular weight of 194.11 g/mol. IUPAC name: 2-methyl-4-(trifluoromethyl)furan-3-carboxylic acid. InChIKey: HYQRECPLHAOWIE-UHFFFAOYSA-N.
| Molecular formula | C7H5F3O3 |
|---|---|
| Molecular weight | 194.11 g/mol |
| IUPAC name | 2-methyl-4-(trifluoromethyl)furan-3-carboxylic acid |
| InChIKey | HYQRECPLHAOWIE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CO1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)