Products 1396397-19-5
CAS 1396397-19-5 is the registry number for LASSBio-1359. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-N-methylbenzamide (CAS 1396397-19-5) is a chemical compound with the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. IUPAC name: N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-N-methylbenzamide. InChIKey: ZKKIMIBBUMDNHP-LDADJPATSA-N.
| Molecular formula | C17H18N2O3 |
|---|---|
| Molecular weight | 298.34 g/mol |
| IUPAC name | N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-N-methylbenzamide |
| InChIKey | ZKKIMIBBUMDNHP-LDADJPATSA-N |
| SMILES | CN(C(=O)C1=CC=CC=C1)/N=C/C2=CC(=C(C=C2)OC)OC |
Computed by PubChem (NCBI)