Products 1397193-35-9

CAS 1397193-35-9 is the registry number for 3-(2,6-Difluoro-4-methoxyphenyl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-(2,6-difluoro-4-methoxyphenyl)propanoic acid (CAS 1397193-35-9) is a chemical compound with the molecular formula C10H10F2O3 and a molecular weight of 216.18 g/mol. IUPAC name: 3-(2,6-difluoro-4-methoxyphenyl)propanoic acid. InChIKey: BRJVIDYBEXLDEU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10F2O3
Molecular weight216.18 g/mol
IUPAC name3-(2,6-difluoro-4-methoxyphenyl)propanoic acid
InChIKeyBRJVIDYBEXLDEU-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C(=C1)F)CCC(=O)O)F

Computed by PubChem (NCBI)