Products 13979-61-8
CAS 13979-61-8 appears in our catalog under these names: 3-Bromo-5-methoxy-2-methylbenzoic acid, 95%, 3–Bromo–5–methoxy–2–methyl–benzoic acid, 3-bromo-5-methoxy-2-methylbenzoic acid, 3-Bromo-5-methoxy-2-methylbenzoic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 100mg, 0,5g, 50mg.
3-bromo-5-methoxy-2-methylbenzoic acid (CAS 13979-61-8) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: 3-bromo-5-methoxy-2-methylbenzoic acid. InChIKey: PYVLOORQWWPGCY-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO3 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | 3-bromo-5-methoxy-2-methylbenzoic acid |
| InChIKey | PYVLOORQWWPGCY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1Br)OC)C(=O)O |
Computed by PubChem (NCBI)