Products 1398065-60-5
CAS 1398065-60-5 appears in our catalog under these names: 2-(3-Ethoxy-4-methoxy-d3-phenyl)ethyl-1,1,2,2-d4-amine HCl, 99 atom % D, min 98% Chemical Purity, 2-(3-Ethoxy-4-methoxy-d3-phenyl)ethyl-1,1,2,2-d4-amine hydrochloride, 3-Ethoxy-4-methoxy-Dopamine-d7 (hydrochloride). Offered by: CDN, Biosynth, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 25mg, 100mg, 50mg, 5 mg, 100 mg, 50 mg.
1,1,2,2-tetradeuterio-2-[3-ethoxy-4-(trideuteriomethoxy)phenyl]ethanamine;hydrochloride (CAS 1398065-60-5) is a chemical compound with the molecular formula C11H18ClNO2 and a molecular weight of 238.76 g/mol. IUPAC name: 1,1,2,2-tetradeuterio-2-[3-ethoxy-4-(trideuteriomethoxy)phenyl]ethanamine;hydrochloride. InChIKey: YXLSDLKSKODYFG-VPTCIXLOSA-N.
| Molecular formula | C11H18ClNO2 |
|---|---|
| Molecular weight | 238.76 g/mol |
| IUPAC name | 1,1,2,2-tetradeuterio-2-[3-ethoxy-4-(trideuteriomethoxy)phenyl]ethanamine;hydrochloride |
| InChIKey | YXLSDLKSKODYFG-VPTCIXLOSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=C(C=C1)C([2H])([2H])C([2H])([2H])N)OCC.Cl |
Computed by PubChem (NCBI)