Products 1398065-82-1
CAS 1398065-82-1 appears in our catalog under these names: Propanil-d5, >95% (HPLC), Propanil-d5, >95% (HPLC), 3',4'-Dichloropropionanilide-2,2,3,3,3-d5, 98 atom % D, min 98% Chemical Purity, Propanil-d5. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 50mg, 5mg, 0,05g, 0,01g, 5 mg, 50 mg.
2,2,3,3,3-pentadeuterio-N-(3,4-dichlorophenyl)propanamide (CAS 1398065-82-1) is a chemical compound with the molecular formula C9H9Cl2NO and a molecular weight of 223.11 g/mol. IUPAC name: 2,2,3,3,3-pentadeuterio-N-(3,4-dichlorophenyl)propanamide. InChIKey: LFULEKSKNZEWOE-ZBJDZAJPSA-N.
| Molecular formula | C9H9Cl2NO |
|---|---|
| Molecular weight | 223.11 g/mol |
| IUPAC name | 2,2,3,3,3-pentadeuterio-N-(3,4-dichlorophenyl)propanamide |
| InChIKey | LFULEKSKNZEWOE-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C(=O)NC1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)