CAS 6333-36-4 is the registry number for 2,4-Dichloro-n,n-dimethylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2,4-dichloro-N,N-dimethylbenzamide (CAS 6333-36-4) is a chemical compound with the molecular formula C9H9Cl2NO and a molecular weight of 218.08 g/mol. IUPAC name: 2,4-dichloro-N,N-dimethylbenzamide. InChIKey: MAKRFNZHAIRMQG-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO |
|---|---|
| Molecular weight | 218.08 g/mol |
| IUPAC name | 2,4-dichloro-N,N-dimethylbenzamide |
| InChIKey | MAKRFNZHAIRMQG-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)